|
Name | Chlorpromazine |
2D and 3D depictions | |
SMILES | CN(C)CCCn3c1ccccc1sc2ccc(Cl)cc23 |
Model downloads | |
Fingerprints |
Name | Amodiaquine |
2D and 3D depictions | |
SMILES | CCN(CC)Cc3cc(Nc1ccnc2cc(Cl)ccc12)ccc3O |
Model downloads | |
Fingerprints |
Name | Amodiaquine hydrochloride |
2D and 3D depictions | |
SMILES | Cl.Cl.CCN(CC)Cc3cc(Nc1ccnc2cc(Cl)ccc12)ccc3O |
Model downloads | |
Fingerprints |
Name | Mefloquine |
2D and 3D depictions | |
SMILES | OC(c1cc(C(F)(F)F)nc2c(C(F)(F)F)cccc12)C3CCCCN3 |
Model downloads | |
Fingerprints |
Name | Imatinib |
2D and 3D depictions | |
SMILES | Cc3ccc(NC(=O)c2ccc(CN1CCN(C)CC1)cc2)cc3Nc5nccc(c4cccnc4)n5 |
Model downloads | |
Fingerprints |