On Target NS3_HCV1A 0.26530612/CHEMBL3645714
For the given ligand Chlorpromazine, we have found in our database that, being scored 0.26530612, the most similar ligand is CHEMBL3645714. Check out the elaboration below.
| Chlorpromazine (Given Ligand) | CHEMBL3645714 (Similar Ligand) |
|---|---|
| CN(C)CCCn3c1ccccc1sc2ccc(Cl)cc23 | C=C[C@@H]1C[C@]1(NC(=O)[C@@H]1C[C@@]2(CN1C(=O)[C@@H](NC(=O)C(NC(=O)[C@@H]1SCCN1CC)C1CCCCC1)C(C)(C)C)C(C)(C)C21CCC1)C(=O)NS(=O)(=O)N1CCCC1 |
|
|
|
|
|
|
| 00020000 43000400 20100000 08100400 40100000 00000000 00000000 20000000 04200000 020241e0 00200000 40030000 00010006 00040000 00000000 00000000 04000000 00000000 02002000 00000201 40000000 10000110 00000340 04300012 00000000 08000000 00004000 10000000 00000000 00040030 00000000 03833a00 | 000100a0 4d003000 26104000 0d300400 00010000 00000010 800a0000 20001408 10000000 0216c188 00602000 40013000 0601801e 010c2011 a0400400 00000000 04004400 00000200 46012000 00004209 00000000 30040632 00000203 36900038 10000000 00000000 00004000 90000050 08000000 c0040081 64024014 030122e0 |