On Target ACE2_HUMAN 0.29069766/CHEMBL401086
For the given ligand Chlorpromazine, we have found in our database that, being scored 0.29069766, the most similar ligand is CHEMBL401086. Check out the elaboration below.
| Chlorpromazine (Given Ligand) | CHEMBL401086 (Similar Ligand) |
|---|---|
| CN(C)CCCn3c1ccccc1sc2ccc(Cl)cc23 | CC[C@@H](C)[C@H](S)C(=O)NCC(=O)O |
|
|
|
|
|
|
| 00020000 43000400 20100000 08100400 40100000 00000000 00000000 20000000 04200000 020241e0 00200000 40030000 00010006 00040000 00000000 00000000 04000000 00000000 02002000 00000201 40000000 10000110 00000340 04300012 00000000 08000000 00004000 10000000 00000000 00040030 00000000 03833a00 | 00010000 01004000 00100000 00100400 00000080 00000000 80000000 20000000 00000000 02080080 00200000 40013000 06008002 00040000 80080000 00080008 10000000 00000000 00000000 00000201 00000000 10000e00 02000100 04100018 00000000 00000000 00000000 10000040 00000000 00040001 20004000 03010200 |