On Target NS5B_HCV1A 0.4265403/CHEMBL353549
For the given ligand Mefloquine, we have found in our database that, being scored 0.4265403, the most similar ligand is CHEMBL353549. Check out the elaboration below.
| Mefloquine (Given Ligand) | CHEMBL353549 (Similar Ligand) |
|---|---|
| OC(c1cc(C(F)(F)F)nc2c(C(F)(F)F)cccc12)C3CCCCN3 | O=C(N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)c1ccc2c(c1)nc(-c1ccoc1)n2C1CCCCC1 |
|
|
|
|
|
|
| 00000002 01050800 00104102 50050610 000c10a0 0000c000 00004c00 20000000 00400980 000808f0 0c300004 50018802 98000802 01e08000 001a0040 020c000c 10000020 02000000 00602000 40000201 40000100 18208038 23800000 81400010 00042002 c0000000 08000140 90000010 04000006 00060002 40160000 00002620 | 0000800a 0120f890 00180100 51850612 200c10e1 00006000 00002000 0220100c 00424980 900918c0 0d30800c 4001b000 5e009c02 00c08800 000204c0 028c000c 10000008 02002004 02e02408 00400201 c0120100 38268e38 23800041 9158001c 00047801 c0004000 08400050 98800000 04400104 04460c43 e00cca00 000006a0 |