On Target NS5B_HCV1B 0.32635984/CHEMBL3645194
For the given ligand Imatinib, we have found in our database that, being scored 0.32635984, the most similar ligand is CHEMBL3645194. Check out the elaboration below.
| Imatinib (Given Ligand) | CHEMBL3645194 (Similar Ligand) |
|---|---|
| Cc3ccc(NC(=O)c2ccc(CN1CCN(C)CC1)cc2)cc3Nc5nccc(c4cccnc4)n5 | CCN(c1cc2nn(-c3ccc(Cl)cc3)c(C(=O)NC)c2cc1C1CC1)S(C)(=O)=O |
|
|
|
|
|
|
| 0001e202 00010800 80004100 44050610 09041004 04004000 00002800 02081000 00000100 00010840 00280004 6000d810 82008802 0010a000 00020440 800c0004 00060000 12006004 0c600000 10a00006 40100000 2c02a600 31812860 0240011c 000c0003 c0180000 08000600 800110e0 08c0810c 00460801 c0040800 200002a2 | 0000c006 00805e08 20080902 41310e00 010c0000 00004042 02040000 02001408 00100900 000908c0 09312024 40118800 82008c27 01400201 800a0040 000e200c 04268000 02000604 08600008 00224201 c0100101 1c838f38 20800800 8360001c 02106080 c0000040 002f0080 8000108c 0c488104 0046004b c4048080 a01347e0 |