On Target NA_INFB 0.23243243/CHEMBL4161935
For the given ligand Amodiaquine, we have found in our database that, being scored 0.23243243, the most similar ligand is CHEMBL4161935. Check out the elaboration below.
| Amodiaquine (Given Ligand) | CHEMBL4161935 (Similar Ligand) |
|---|---|
| CCN(CC)Cc3cc(Nc1ccnc2cc(Cl)ccc12)ccc3O | CCC(CC)O[C@@H]1C=C(C(=O)O)C[C@H](NCc2ccc(N(CC)CC)cc2)[C@H]1NC(C)=O |
|
|
|
|
|
|
| 10018002 00000008 20004100 00010600 000c0000 08000000 0a008010 02001400 00802000 00100850 00300004 40008800 02000826 00400000 00000440 0004200c 00040000 02000000 08200002 00020000 41000000 08048108 20800000 80400000 00046000 c0000000 02048000 80000080 00408100 00060000 04040000 00420240 | 00074042 09007800 00100100 84010700 00180080 00000800 02080180 3a00140a 11000000 001108c8 40200004 41019001 0402881a 0188a000 00001448 00081008 10a44000 02000060 68c12010 00000201 40100020 38048e80 33008080 02500018 10001401 c0001400 00c04000 90000081 0c008300 00060401 24060000 00800a10 |