On Target RDRP_SARS2 0.09965636/CHEMBL4065616
For the given ligand Chlorpromazine, we have found in our database that, being scored 0.09965636, the most similar ligand is CHEMBL4065616. Check out the elaboration below.
| Chlorpromazine (Given Ligand) | CHEMBL4065616 (Similar Ligand) |
|---|---|
| CN(C)CCCn3c1ccccc1sc2ccc(Cl)cc23 | CCC(COC(=O)[C@@H](NP(=O)(Oc1ccccc1)OC[C@H]1O[C@@]([C@@H]([C@@H]1O)O)(C#N)c1ccc2n1ncnc2N)C)CC |
|
|
|
|
|
|
| 00020000 43000400 20100000 08100400 40100000 00000000 00000000 20000000 04200000 020241e0 00200000 40030000 00010006 00040000 00000000 00000000 04000000 00000000 02002000 00000201 40000000 10000110 00000340 04300012 00000000 08000000 00004000 10000000 00000000 00040030 00000000 03833a00 | 0020004a 81144109 f2103512 99010f60 452c80f4 8008c004 0303c401 00200a20 19404b00 010c0844 08189004 4ac7b168 00009802 02b30020 000e9040 028eba8c 084b8830 06800005 21662008 00665243 60120120 3e008a60 a7801cc6 08700110 10000400 80002000 0f0892c0 900388a0 0240128f 00c6cc36 55400280 22339c84 |