On Target NP_HCoV-OC43 0.10526316/CHEMBL3233481
For the given ligand Chlorpromazine, we have found in our database that, being scored 0.10526316, the most similar ligand is CHEMBL3233481. Check out the elaboration below.
| Chlorpromazine (Given Ligand) | CHEMBL3233481 (Similar Ligand) |
|---|---|
| CN(C)CCCn3c1ccccc1sc2ccc(Cl)cc23 | CN(C)CC(=O)Nc1ccc2[nH]c(=O)c3ccccc3c2c1.Cl |
|
|
|
|
|
|
| 00020000 43000400 20100000 08100400 40100000 00000000 00000000 20000000 04200000 020241e0 00200000 40030000 00010006 00040000 00000000 00000000 04000000 00000000 02002000 00000201 40000000 10000110 00000340 04300012 00000000 08000000 00004000 10000000 00000000 00040030 00000000 03833a00 | 00004002 00800000 00004020 00000600 00040000 00000060 00000000 00000000 06000000 40000a60 04280004 4000a000 00008800 00702000 00100040 00040004 00040000 00000008 08200000 00000004 40100000 28008608 20802000 80100002 00000000 40000000 00000000 00000080 08008000 00060001 00044000 00020200 |