On Target NS3_HCV1A 0.72289157/CHEMBL296588
For the given ligand Cyclosporine, we have found in our database that, being scored 0.72289157, the most similar ligand is CHEMBL296588. Check out the elaboration below.
| Cyclosporine (Given Ligand) | CHEMBL296588 (Similar Ligand) |
|---|---|
| C/C=C/C[C@@H](C)[C@@H](O)[C@H]1C(=O)N[C@@H](CC)C(=O)N(C)CC(=O)N(C)[C@@H](CC(C)C)C(=O)N[C@@H](C(C)C)C(=O)N(C)[C@@H](CC(C)C)C(=O)N[C@@H](C)C(=O)N[C@H](C)C(=O)N(C)[C@@H](CC(C)C)C(=O)N(C)[C@@H](CC(C)C)C(=O)N(C)[C@@H](C(C)C)C(=O)N1C | CC(C)CC(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@@H](CC(C)C)[C@@H](O)CC(=O)N[C@@H](C)C(=O)N[C@@H](CC(C)C)[C@@H](O)CC(=O)O)C(C)C)C(C)C |
|
|
|
|
|
|
| 00010000 81007000 00100000 04000400 00000080 00000000 00000000 20000408 00000000 00100080 00200000 40013000 1602800a 00002001 80180400 00080008 10000000 00000000 00c12000 00002201 00000000 30040610 03008083 02100018 00000001 00000000 00404000 90000000 08000000 00040001 24004000 00002200 | 00030000 01007000 00100000 04000400 00180080 00000000 00000000 20000008 00200000 00000080 00200000 40033000 1600800a 00802001 80180000 00080008 10000000 00000000 01c02000 00000201 00000000 30040e10 03000083 02100018 00000001 00000000 00000000 10000000 08000000 00040001 20024000 00802a00 |