On Target NS3_HCV1A 0.42857143/CHEMBL4115040
For the given ligand Tilorone, we have found in our database that, being scored 0.42857143, the most similar ligand is CHEMBL4115040. Check out the elaboration below.
| Tilorone (Given Ligand) | CHEMBL4115040 (Similar Ligand) |
|---|---|
| CCN(CC)CCOc1ccc3c(c1)c(=O)c2cc(OCCN(CC)CC)ccc23 | CC[C@@H](N)c1ccc(Cl)c(C(=O)c2ccc3c(c2)OCCN3)c1F |
|
|
|
|
|
|
| 0c002000 42000809 20000108 80010602 00001080 00008000 02040400 01000000 00400000 00080840 08200000 40008000 00808012 20200080 21005001 20080008 10020000 02000000 04080000 00020200 00000000 08060200 12004010 00420014 00800000 a0000000 00020000 40000041 02004280 00060002 80000000 00000600 | 0400e042 42000808 20101108 c2010602 80001281 00000010 22000000 01001000 00000800 00080e40 08340004 40008a00 02808866 20009084 01005041 28084008 03040200 03000000 08080400 00020201 41100500 18068300 33000000 10428014 00002000 a0000200 28040000 40800081 00008280 00068002 84040000 00020600 |