On Target NS3_HCV1B 0.23109244/CHEMBL1170408
For the given ligand Amodiaquine, we have found in our database that, being scored 0.23109244, the most similar ligand is CHEMBL1170408. Check out the elaboration below.
| Amodiaquine (Given Ligand) | CHEMBL1170408 (Similar Ligand) |
|---|---|
| CCN(CC)Cc3cc(Nc1ccnc2cc(Cl)ccc12)ccc3O | C=CCCCS(=O)(=O)NC(=O)[C@H](CCC)NC(=O)[C@@H](NC(=O)[C@@H](NC(=O)OC(C)(C)C)C(C)(C)C)c1ccc(Oc2cc(-c3ccccc3)nc3cc(OC)ccc23)c(C=C)c1 |
|
|
|
|
|
|
| 10018002 00000008 20004100 00010600 000c0000 08000000 0a008010 02001400 00802000 00100850 00300004 40008800 02000826 00400000 00000440 0004200c 00040000 02000000 08200002 00020000 41000000 08048108 20800000 80400000 00046000 c0000000 02048000 80000080 00408100 00060000 04040000 00420240 | 08012082 65c03008 20184108 15310600 00241021 00018000 96060080 22081408 20800284 105988c0 08202404 4011b000 0f00c802 00442001 c1420441 025ea00c 02020040 02082004 04282810 00465a01 c0400000 bc248e19 30800103 b3440038 02000000 c0000002 08322048 9020406c 0c404384 00260403 a4067c00 01252670 |