On Target PA_INFA 0.4695652/CHEMBL2040554
For the given ligand Loperamide, we have found in our database that, being scored 0.4695652, the most similar ligand is CHEMBL2040554. Check out the elaboration below.
| Loperamide (Given Ligand) | CHEMBL2040554 (Similar Ligand) |
|---|---|
| CN(C)C(=O)C(CCN2CCC(O)(c1ccc(Cl)cc1)CC2)(c3ccccc3)c4ccccc4 | O=C(O)/C(O)=C/C(=O)C1(Cc2ccc(Cl)cc2)CCN(CC2CCCCC2)CC1 |
|
|
|
|
|
|
| 00028000 01000200 00100100 00010600 00000000 00004000 00000000 21000000 00200900 000808c0 08300000 50039800 070080a6 00000000 40000000 000c0008 00000000 02000000 00800000 00000201 00000100 18200720 01000080 81500010 00002001 a0000000 00040000 50000000 04000080 0006000b 40002000 00822600 | 00028000 01000000 00100102 00010600 00000000 00000000 00000080 28000400 01100800 001808c0 08300000 5001d800 86028026 00200000 00000400 00080008 00000000 02000000 02252018 00000201 00000100 18000b90 04008000 00500010 00003800 80002400 00444000 90000000 00004000 00060002 04020000 00822600 |