On Target NS5B_HCV1B 0.2783019/CHEMBL3645208
For the given ligand Loperamide, we have found in our database that, being scored 0.2783019, the most similar ligand is CHEMBL3645208. Check out the elaboration below.
| Loperamide (Given Ligand) | CHEMBL3645208 (Similar Ligand) |
|---|---|
| CN(C)C(=O)C(CCN2CCC(O)(c1ccc(Cl)cc1)CC2)(c3ccccc3)c4ccccc4 | CNC(=O)c1c2cc(C3CC3)c(N(CCCO)S(C)(=O)=O)cc2nn1-c1ccc(Cl)cc1 |
|
|
|
|
|
|
| 00028000 01000200 00100100 00010600 00000000 00004000 00000000 21000000 00200900 000808c0 08300000 50039800 070080a6 00000000 40000000 000c0008 00000000 02000000 00800000 00000201 00000100 18200720 01000080 81500010 00002001 a0000000 00040000 50000000 04000080 0006000b 40002000 00822600 | 0000c006 00805e08 20180902 41310e00 210c0000 00004042 02040000 02001408 00100900 004908c0 09312024 40118800 82008c27 01400201 810a0040 000e200e 04268000 02400604 08e00008 00224205 c0100101 1c838f38 21800880 9360001c 02106080 c0000040 002f0080 8000108c 0c488104 0046004b c4048080 a01347e0 |