On Target NS5B_HCV1B 0.20661157/CHEMBL3645182
For the given ligand Tilorone, we have found in our database that, being scored 0.20661157, the most similar ligand is CHEMBL3645182. Check out the elaboration below.
| Tilorone (Given Ligand) | CHEMBL3645182 (Similar Ligand) |
|---|---|
| CCN(CC)CCOc1ccc3c(c1)c(=O)c2cc(OCCN(CC)CC)ccc23 | CNC(=O)c1c2cc(C3CC3)c(N(CCN3CCOCC3)S(C)(=O)=O)cc2nn1-c1ccc(Oc2ccc(F)cc2)cc1 |
|
|
|
|
|
|
| 0c002000 42000809 20000108 80010602 00001080 00008000 02040400 01000000 00400000 00080840 08200000 40008000 00808012 20200080 21005001 20080008 10020000 02000000 04080000 00020200 00000000 08060200 12004010 00420014 00800000 a0000000 00020000 40000041 02004280 00060002 80000000 00000600 | 00004086 00805e08 2018092a c7310e00 010c1080 00004052 02060000 02001408 00100900 00090ac0 09312024 40118800 80008c23 01403201 811a1049 000ea10c 14268000 02000004 08602008 00624201 c0500101 3c838e38 32801800 a360003e 02104480 c0000040 00270080 8020108d 0c488304 0046804b c4048480 a31147e0 |