On Target PR_SARS 0.2977528/CHEMBL2441741
For the given ligand Mefloquine, we have found in our database that, being scored 0.2977528, the most similar ligand is CHEMBL2441741. Check out the elaboration below.
| Mefloquine (Given Ligand) | CHEMBL2441741 (Similar Ligand) |
|---|---|
| OC(c1cc(C(F)(F)F)nc2c(C(F)(F)F)cccc12)C3CCCCN3 | CC(C)C[C@H](NC(=O)[C@H](Cc1cccc2ccccc12)NC(=O)OCc1ccccc1)C(=O)N[C@H](C=O)C[C@@H]1CCNC1=O |
|
|
|
|
|
|
| 00000002 01050800 00104102 50050610 000c10a0 0000c000 00004c00 20000000 00400980 000808f0 0c300004 50018802 98000802 01e08000 001a0040 020c000c 10000020 02000000 00602000 40000201 40000100 18208038 23800000 81400010 00042002 c0000000 08000140 90000010 04000006 00060002 40160000 00002620 | 01030000 01403200 00100100 04010600 00000000 0001c010 00000000 2000000c 00e00b00 000a08c0 08300000 4003b000 0e00801a 00012001 80000000 021e0008 00020000 02080400 00002898 00000201 00000100 38240e38 00000003 83500018 00000800 80002002 00000000 10200020 0c000200 0006000b e0004000 00802600 |