On Target NP_HCoV-OC43 0.30088496/CHEMBL3233481
For the given ligand Amodiaquine, we have found in our database that, being scored 0.30088496, the most similar ligand is CHEMBL3233481. Check out the elaboration below.
| Amodiaquine (Given Ligand) | CHEMBL3233481 (Similar Ligand) |
|---|---|
| CCN(CC)Cc3cc(Nc1ccnc2cc(Cl)ccc12)ccc3O | CN(C)CC(=O)Nc1ccc2[nH]c(=O)c3ccccc3c2c1.Cl |
|
|
|
|
|
|
| 10018002 00000008 20004100 00010600 000c0000 08000000 0a008010 02001400 00802000 00100850 00300004 40008800 02000826 00400000 00000440 0004200c 00040000 02000000 08200002 00020000 41000000 08048108 20800000 80400000 00046000 c0000000 02048000 80000080 00408100 00060000 04040000 00420240 | 00004002 00800000 00004020 00000600 00040000 00000060 00000000 00000000 06000000 40000a60 04280004 4000a000 00008800 00702000 00100040 00040004 00040000 00000008 08200000 00000004 40100000 28008608 20802000 80100002 00000000 40000000 00000000 00000080 08008000 00060001 00044000 00020200 |