On Target PLP_SARS 0.41791046/CHEMBL213054
For the given ligand Cyclosporine, we have found in our database that, being scored 0.41791046, the most similar ligand is CHEMBL213054. Check out the elaboration below.
| Cyclosporine (Given Ligand) | CHEMBL213054 (Similar Ligand) |
|---|---|
| C/C=C/C[C@@H](C)[C@@H](O)[C@H]1C(=O)N[C@@H](CC)C(=O)N(C)CC(=O)N(C)[C@@H](CC(C)C)C(=O)N[C@@H](C(C)C)C(=O)N(C)[C@@H](CC(C)C)C(=O)N[C@@H](C)C(=O)N[C@H](C)C(=O)N(C)[C@@H](CC(C)C)C(=O)N(C)[C@@H](CC(C)C)C(=O)N(C)[C@@H](C(C)C)C(=O)N1C | CC(OC(C)(C)C)[C@H](NC(=O)OCc1ccccc1)C(=O)N[C@@H](CC1CCCCC1)C(=O)N[C@H](C=O)C[C@@H]1CCNC1=O |
|
|
|
|
|
|
| 00010000 81007000 00100000 04000400 00000080 00000000 00000000 20000408 00000000 00100080 00200000 40013000 1602800a 00002001 80180400 00080008 10000000 00000000 00c12000 00002201 00000000 30040610 03008083 02100018 00000001 00000000 00404000 90000000 08000000 00040001 24004000 00002200 | 01030000 01407000 00100100 84010600 00040080 0023c010 00000000 20000008 00a00300 000208c0 00200000 4003b000 1e00801a 00092001 80001008 021a0008 00220000 02080400 02802890 01000201 00000020 38040e30 13000083 02500018 00000401 80002002 00800800 10200020 08000200 00060001 e0024000 00802200 |