On Target PLP_SARS 0.28/CHEMBL358279
For the given ligand Amodiaquine, we have found in our database that, being scored 0.28, the most similar ligand is CHEMBL358279. Check out the elaboration below.
| Amodiaquine (Given Ligand) | CHEMBL358279 (Similar Ligand) |
|---|---|
| CCN(CC)Cc3cc(Nc1ccnc2cc(Cl)ccc12)ccc3O | NC(=O)c1ccc2c(c1)C(=O)C(=O)N2Cc1ccc2ccccc2c1 |
|
|
|
|
|
|
| 10018002 00000008 20004100 00010600 000c0000 08000000 0a008010 02001400 00802000 00100850 00300004 40008800 02000826 00400000 00000440 0004200c 00040000 02000000 08200002 00020000 41000000 08048108 20800000 80400000 00046000 c0000000 02048000 80000080 00408100 00060000 04040000 00420240 | 1000c002 00800800 00100100 80010600 20001001 00010040 00800000 02081000 04800080 00080e40 08280004 4000f000 03008802 00108000 40020540 08080008 00048000 02000000 08000400 00000200 c0100400 18228608 20012000 8144001d 00000000 c0000280 08000010 80005080 04088100 00060003 a0047000 20000600 |