On Target NSP1_SARS 0.24539877/CHEMBL3105073
For the given ligand Amodiaquine, we have found in our database that, being scored 0.24539877, the most similar ligand is CHEMBL3105073. Check out the elaboration below.
| Amodiaquine (Given Ligand) | CHEMBL3105073 (Similar Ligand) |
|---|---|
| CCN(CC)Cc3cc(Nc1ccnc2cc(Cl)ccc12)ccc3O | S=C(NCc1cccnc1)SCc1cc(Cl)sc1Cl |
|
|
|
|
|
|
| 10018002 00000008 20004100 00010600 000c0000 08000000 0a008010 02001400 00802000 00100850 00300004 40008800 02000826 00400000 00000440 0004200c 00040000 02000000 08200002 00020000 41000000 08048108 20800000 80400000 00046000 c0000000 02048000 80000080 00408100 00060000 04040000 00420240 | 10018012 00008008 10006d00 01100610 20149004 00404084 04024000 22001000 00000001 03404040 01200204 40200880 0200180c 000c0001 80001000 00040104 04000400 02000304 00200000 01040208 40100000 48008981 20880020 02400000 05040000 04000200 28000400 a0020404 03603100 00060000 00000011 81c30288 |