On Target NS3_HCV1A 0.34412956/CHEMBL3696815
For the given ligand emtricitabine, we have found in our database that, being scored 0.34412956, the most similar ligand is CHEMBL3696815. Check out the elaboration below.
| emtricitabine (Given Ligand) | CHEMBL3696815 (Similar Ligand) |
|---|---|
| Nc2nc(=O)n([C@@H]1CS[C@H](CO)O1)cc2F | CC(C)OC(=O)[C@H](C)NP(=O)(OC[C@H]1O[C@@H](n2ccc(N)nc2=O)[C@](C)(N)C1O)Oc1ccccc1 |
|
|
|
|
|
|
| 00000002 40400000 20140001 8c180640 04080040 000060a0 40009400 00000910 04000100 010040b0 0410900c 40059004 00009000 21dc1010 05a25080 001c100c 04240406 10204000 00402000 00201000 80080000 18000000 25800241 08600800 80030400 40000012 00000200 90003862 00000209 01460000 c0281000 060102c0 | 00200002 01540108 30000310 c9090f40 40180074 00084140 0202d401 80000820 0d004101 818008f4 0400100c 4845b16c 00009002 03ca0130 00289880 009d8a8c 002a0030 00000001 29c60000 00225043 a0080020 3e000a10 27800041 08600810 18000400 40002002 0f001200 10038060 02001289 01460034 55680000 201390c4 |