On Target PA_INFA 0.19067797/CHEMBL2040569
For the given ligand emtricitabine, we have found in our database that, being scored 0.19067797, the most similar ligand is CHEMBL2040569. Check out the elaboration below.
| emtricitabine (Given Ligand) | CHEMBL2040569 (Similar Ligand) |
|---|---|
| Nc2nc(=O)n([C@@H]1CS[C@H](CO)O1)cc2F | O=C(NCC1CC1)c1nc(-c2cnccn2)[nH]c(=O)c1O |
|
|
|
|
|
|
| 00000002 40400000 20140001 8c180640 04080040 000060a0 40009400 00000910 04000100 010040b0 0410900c 40059004 00009000 21dc1010 05a25080 001c100c 04240406 10204000 00402000 00201000 80080000 18000000 25800241 08600800 80030400 40000012 00000200 90003862 00000209 01460000 c0281000 060102c0 | 00000202 00011808 40100100 10040e10 00000068 00124006 00c09800 28003405 16000100 401000a0 00290004 40040810 00008002 01708003 00820400 000c200c 08000068 1200b022 80c00000 10400201 00000000 50058600 21800040 4010011c 00044806 c0000680 28000030 90041004 0000410c 07660c01 e4008000 500002a0 |