On Target RT_HIV1 0.21148036/CHEMBL4108778
For the given ligand tenofovir alafenamide, we have found in our database that, being scored 0.21148036, the most similar ligand is CHEMBL4108778. Check out the elaboration below.
| tenofovir alafenamide (Given Ligand) | CHEMBL4108778 (Similar Ligand) |
|---|---|
| CC(C)OC(=O)[C@H](C)NP(=O)(CO[C@H](C)Cn2cnc1c(N)ncnc12)Oc3ccccc3 | COC(=O)N[C@H](C(=O)N[C@H](c1ccc([C@@H](CO)N(CCC(C)(C)C)S(=O)(=O)c2ccn3ncnc3c2)s1)C(F)(F)F)C(c1ccccc1)c1ccccc1 |
|
|
|
|
|
|
| 0020000b 00941808 b0080400 c8090660 40080051 0000c100 8200c002 00000920 09600108 000088c4 0000800c 4841b048 00009002 00820000 00089080 308ec00d 02220038 00000001 50460200 80220000 a00000a0 1b400a52 23800040 24000214 40020500 00002000 03001200 0843c030 42001209 20460020 c0080000 200090d4 | 000100d2 00903a08 62184100 0db10601 100c00c0 0003e0e4 06031081 2320580e 00c60b08 c04918c0 09302204 e000b880 8c008813 00e02021 804c2440 001e020c 1842b010 0299000c 00700818 0022660d e0001900 7c288eb0 23900802 d370005c 42000c00 e4010006 40000800 d040282c 0c200380 2046000f e0004000 00d107f0 |