On Target NP_HCoV-OC43 0.09223301/CHEMBL3233481
For the given ligand tenofovir alafenamide, we have found in our database that, being scored 0.09223301, the most similar ligand is CHEMBL3233481. Check out the elaboration below.
| tenofovir alafenamide (Given Ligand) | CHEMBL3233481 (Similar Ligand) |
|---|---|
| CC(C)OC(=O)[C@H](C)NP(=O)(CO[C@H](C)Cn2cnc1c(N)ncnc12)Oc3ccccc3 | CN(C)CC(=O)Nc1ccc2[nH]c(=O)c3ccccc3c2c1.Cl |
|
|
|
|
|
|
| 0020000b 00941808 b0080400 c8090660 40080051 0000c100 8200c002 00000920 09600108 000088c4 0000800c 4841b048 00009002 00820000 00089080 308ec00d 02220038 00000001 50460200 80220000 a00000a0 1b400a52 23800040 24000214 40020500 00002000 03001200 0843c030 42001209 20460020 c0080000 200090d4 | 00004002 00800000 00004020 00000600 00040000 00000060 00000000 00000000 06000000 40000a60 04280004 4000a000 00008800 00702000 00100040 00040004 00040000 00000008 08200000 00000004 40100000 28008608 20802000 80100002 00000000 40000000 00000000 00000080 08008000 00060001 00044000 00020200 |