On Target NSP1_SARS 0.15611814/CHEMBL2441741
For the given ligand tenofovir alafenamide, we have found in our database that, being scored 0.15611814, the most similar ligand is CHEMBL2441741. Check out the elaboration below.
| tenofovir alafenamide (Given Ligand) | CHEMBL2441741 (Similar Ligand) |
|---|---|
| CC(C)OC(=O)[C@H](C)NP(=O)(CO[C@H](C)Cn2cnc1c(N)ncnc12)Oc3ccccc3 | CC(C)C[C@H](NC(=O)[C@H](Cc1cccc2ccccc12)NC(=O)OCc1ccccc1)C(=O)N[C@H](C=O)C[C@@H]1CCNC1=O |
|
|
|
|
|
|
| 0020000b 00941808 b0080400 c8090660 40080051 0000c100 8200c002 00000920 09600108 000088c4 0000800c 4841b048 00009002 00820000 00089080 308ec00d 02220038 00000001 50460200 80220000 a00000a0 1b400a52 23800040 24000214 40020500 00002000 03001200 0843c030 42001209 20460020 c0080000 200090d4 | 01030000 01403200 00100100 04010600 00000000 0001c010 00000000 2000000c 00e00b00 000a08c0 08300000 4003b000 0e00801a 00012001 80000000 021e0008 00020000 02080400 00002898 00000201 00000100 38240e38 00000003 83500018 00000800 80002002 00000000 10200020 0c000200 0006000b e0004000 00802600 |