On Target NS3_HCV1A 0.36363637/CHEMBL4110799
For the given ligand Bromfenac, we have found in our database that, being scored 0.36363637, the most similar ligand is CHEMBL4110799. Check out the elaboration below.
| Bromfenac (Given Ligand) | CHEMBL4110799 (Similar Ligand) |
|---|---|
| Nc1c(CC(=O)O)cccc1C(=O)c2ccc(Br)cc2 | CC[C@@H](N)c1ccc(F)c(C(=O)c2ccccc2)c1F |
|
|
|
|
|
|
| 00004002 00008800 00000100 00010200 00000041 00090000 00000000 01000000 00000000 00080a40 08000004 40009200 01008010 00000000 41060040 08080008 08000000 02000401 00000000 00000000 40000000 08020a00 21000000 00400014 00000000 a0000200 00120000 40804004 00000080 00061002 80002008 28000400 | 00000040 00000800 00100100 02010600 00000201 00000010 00000000 01001000 00000800 00090e40 08100000 c0008200 00008840 00001000 00000000 08080008 03000200 02000180 00000400 00100001 00000100 18028200 01000000 10400014 00000000 a0000000 08000000 40800001 00000080 00068002 80040000 00000600 |