Created at: Last updated at: Current status:
|
Name | Bendazac |
2D and 3D depictions | |
SMILES | O=C(O)COc2nn(Cc1ccccc1)c3ccccc23 |
Model downloads | |
Fingerprints |
Name | Nepafenac |
2D and 3D depictions | |
SMILES | NC(=O)Cc2cccc(C(=O)c1ccccc1)c2N |
Model downloads | |
Fingerprints |
Name | Cortisone acetate |
2D and 3D depictions | |
SMILES | CC(=O)OCC(=O)[C@@]4(O)CC[C@H]3[C@@H]2CC/C1=C/C(=O)CCC1(C)[C@H]2C(=O)C[C@@]34C |
Model downloads | |
Fingerprints |
Name | Bromfenac |
2D and 3D depictions | |
SMILES | Nc1c(CC(=O)O)cccc1C(=O)c2ccc(Br)cc2 |
Model downloads | |
Fingerprints |
Name | Flurbiprofen |
2D and 3D depictions | |
SMILES | CC(C(=O)O)c2ccc(c1ccccc1)c(F)c2 |
Model downloads | |
Fingerprints |