On Target NS3_HCV1A 0.41111112/CHEMBL4110799
For the given ligand Nepafenac, we have found in our database that, being scored 0.41111112, the most similar ligand is CHEMBL4110799. Check out the elaboration below.
| Nepafenac (Given Ligand) | CHEMBL4110799 (Similar Ligand) |
|---|---|
| NC(=O)Cc2cccc(C(=O)c1ccccc1)c2N | CC[C@@H](N)c1ccc(F)c(C(=O)c2ccccc2)c1F |
|
|
|
|
|
|
| 00000002 00000800 00000100 00010600 00001001 00090000 00000000 01000000 00000000 00080a40 08000004 40009200 01008000 00000000 40020040 08080008 00000000 02000001 00000010 00000000 40000000 18020600 20000000 81400014 00000000 a0000200 00000000 40804000 04000080 00060002 80002000 20000400 | 00000040 00000800 00100100 02010600 00000201 00000010 00000000 01001000 00000800 00090e40 08100000 c0008200 00008840 00001000 00000000 08080008 03000200 02000180 00000400 00100001 00000100 18028200 01000000 10400014 00000000 a0000000 08000000 40800001 00000080 00068002 80040000 00000600 |