On Target NS3_HCV1A 0.37362638/CHEMBL4107728
For the given ligand Flurbiprofen, we have found in our database that, being scored 0.37362638, the most similar ligand is CHEMBL4107728. Check out the elaboration below.
| Flurbiprofen (Given Ligand) | CHEMBL4107728 (Similar Ligand) |
|---|---|
| CC(C(=O)O)c2ccc(c1ccccc1)c(F)c2 | CC[C@@H](N)c1ccc(C)c(C(=O)c2ccccc2)c1F |
|
|
|
|
|
|
| 00002000 00000000 00100100 02010200 00000040 00000010 00000000 00000000 00000100 00082840 08000000 50009800 01008000 00001000 40040000 00080008 08020200 02000000 04000000 10000000 00000000 08000a00 11000000 00400010 00000004 80000000 80000000 00000041 00404000 00028002 00002000 00000600 | 00000040 00000800 00100100 02010600 00000201 00008010 00000400 01001000 00000900 00082e40 08100000 50008a00 80008840 00201000 00000000 08080008 03000200 02000000 00000400 00000001 00000100 18028200 01004000 10400014 00000000 a0000000 08000000 40800001 02000080 00068002 80040000 00000600 |