On Target NS3_HCV1B 0.20089285/CHEMBL1170408
For the given ligand Nepafenac, we have found in our database that, being scored 0.20089285, the most similar ligand is CHEMBL1170408. Check out the elaboration below.
| Nepafenac (Given Ligand) | CHEMBL1170408 (Similar Ligand) |
|---|---|
| NC(=O)Cc2cccc(C(=O)c1ccccc1)c2N | C=CCCCS(=O)(=O)NC(=O)[C@H](CCC)NC(=O)[C@@H](NC(=O)[C@@H](NC(=O)OC(C)(C)C)C(C)(C)C)c1ccc(Oc2cc(-c3ccccc3)nc3cc(OC)ccc23)c(C=C)c1 |
|
|
|
|
|
|
| 00000002 00000800 00000100 00010600 00001001 00090000 00000000 01000000 00000000 00080a40 08000004 40009200 01008000 00000000 40020040 08080008 00000000 02000001 00000010 00000000 40000000 18020600 20000000 81400014 00000000 a0000200 00000000 40804000 04000080 00060002 80002000 20000400 | 08012082 65c03008 20184108 15310600 00241021 00018000 96060080 22081408 20800284 105988c0 08202404 4011b000 0f00c802 00442001 c1420441 025ea00c 02020040 02082004 04282810 00465a01 c0400000 bc248e19 30800103 b3440038 02000000 c0000002 08322048 9020406c 0c404384 00260403 a4067c00 01252670 |