On Target NS3_HCV1B 0.24528302/CHEMBL1170417
For the given ligand Bendazac, we have found in our database that, being scored 0.24528302, the most similar ligand is CHEMBL1170417. Check out the elaboration below.
| Bendazac (Given Ligand) | CHEMBL1170417 (Similar Ligand) |
|---|---|
| O=C(O)COc2nn(Cc1ccccc1)c3ccccc23 | C=Cc1cc([C@@H](NC(=O)[C@@H](NC(=O)OC(C)(C)C)C(C)(C)C)C(=O)N[C@@H](CCC)C(=O)NS(=O)(=O)c2ccccc2C=C)ccc1Oc1cc(-c2ccccc2)nc2cc(OC)ccc12 |
|
|
|
|
|
|
| 04000004 02000618 20000108 00210600 000c1040 00000000 06008000 00001000 00100200 000008c0 000c0008 4001c000 0080d806 00e00200 41e40001 021c001c 08002008 82000800 00600000 00260000 00040000 1c018a18 05800801 8b600000 00100840 80000044 00008008 00800000 04000200 00060008 00040000 0a404020 | 08012092 41c03008 21104108 15b10600 002c1021 00018008 96060080 22081408 80800284 1049a8c0 08202004 6001b000 0f008802 0040a001 c1720441 025ea00c 020220c0 02082004 04682810 80467e01 c0400000 38248e18 30800003 bb400038 02002000 c0000006 88322048 9020406c 0c404784 20260403 a4067c02 00252670 |