On Target PA_INFA 0.30555555/CHEMBL3600947
For the given ligand Bromfenac, we have found in our database that, being scored 0.30555555, the most similar ligand is CHEMBL3600947. Check out the elaboration below.
| Bromfenac (Given Ligand) | CHEMBL3600947 (Similar Ligand) |
|---|---|
| Nc1c(CC(=O)O)cccc1C(=O)c2ccc(Br)cc2 | O=C(COc1ccc(F)cc1)c1ccc(O)c(O)c1O |
|
|
|
|
|
|
| 00004002 00008800 00000100 00010200 00000041 00090000 00000000 01000000 00000000 00080a40 08000004 40009200 01008010 00000000 41060040 08080008 08000000 02000401 00000000 00000000 40000000 08020a00 21000000 00400014 00000000 a0000200 00120000 40804004 00000080 00061002 80002008 28000400 | 04001001 42000808 20110109 02010200 00001041 02020010 02000000 00000240 00000000 00080840 08040000 4000c100 00808002 00001000 01040001 2008a008 08000000 82000000 04000000 00420a00 00000000 08020200 01001000 00400014 00000000 80000000 00120008 00000001 00000200 00028002 80000000 00000600 |