On Target PA_INFA 0.33653846/CHEMBL2040552
For the given ligand Nepafenac, we have found in our database that, being scored 0.33653846, the most similar ligand is CHEMBL2040552. Check out the elaboration below.
| Nepafenac (Given Ligand) | CHEMBL2040552 (Similar Ligand) |
|---|---|
| NC(=O)Cc2cccc(C(=O)c1ccccc1)c2N | O=C(O)/C(O)=C/C(=O)c1ccc(N2CCNCC2)cc1 |
|
|
|
|
|
|
| 00000002 00000800 00000100 00010600 00001001 00090000 00000000 01000000 00000000 00080a40 08000004 40009200 01008000 00000000 40020040 08080008 00000000 02000001 00000010 00000000 40000000 18020600 20000000 81400014 00000000 a0000200 00000000 40804000 04000080 00060002 80002000 20000400 | 00004002 00000800 00000120 c4010600 00000000 00800000 00000001 00000400 01000000 00980a40 08200004 4000c000 80008002 0000a000 00000040 00080008 00040400 02100000 08250010 00000800 40100000 38020a80 24008020 02400016 00001000 84004400 00400000 00000080 0800c000 00060002 84000000 00000600 |