On Target PA_INFA 0.37804878/CHEMBL1829211
For the given ligand Flurbiprofen, we have found in our database that, being scored 0.37804878, the most similar ligand is CHEMBL1829211. Check out the elaboration below.
| Flurbiprofen (Given Ligand) | CHEMBL1829211 (Similar Ligand) |
|---|---|
| CC(C(=O)O)c2ccc(c1ccccc1)c(F)c2 | O=C(O)/C(O)=C/C(=O)c1ccc(-c2ccccc2)cc1 |
|
|
|
|
|
|
| 00002000 00000000 00100100 02010200 00000040 00000010 00000000 00000000 00000100 00082840 08000000 50009800 01008000 00001000 40040000 00080008 08020200 02000000 04000000 10000000 00000000 08000a00 11000000 00400010 00000004 80000000 80000000 00000041 00404000 00028002 00002000 00000600 | 00002000 00000800 00000100 40010200 00000000 00800000 00000001 00000400 01000100 00980840 08000000 4000c800 80008000 00000000 00000000 00080008 00020400 02100000 04250010 10000800 00000000 18020a80 14008000 00400014 00001000 84004400 00400000 00000040 00004000 00020002 84000000 00000400 |