On Target PR_HIV1 0.2669903/CHEMBL494500
For the given ligand Bendazac, we have found in our database that, being scored 0.2669903, the most similar ligand is CHEMBL494500. Check out the elaboration below.
| Bendazac (Given Ligand) | CHEMBL494500 (Similar Ligand) |
|---|---|
| O=C(O)COc2nn(Cc1ccccc1)c3ccccc23 | COc1ccc(S(=O)(=O)N(CC(C)C)C[C@@H](O)[C@H](Cc2ccccc2)NC(=O)O[C@H]2CCCOCC2)cc1 |
|
|
|
|
|
|
| 04000004 02000618 20000108 00210600 000c1040 00000000 06008000 00001000 00100200 000008c0 000c0008 4001c000 0080d806 00e00200 41e40001 021c001c 08002008 82000800 00600000 00260000 00040000 1c018a18 05800801 8b600000 00100840 80000044 00008008 00800000 04000200 00060008 00040000 0a404020 | 00000050 01c05408 2110010a 01b10700 002810c0 00028000 02000000 a0000004 00540a00 014809e0 08342000 60018000 00008002 00a00101 81e80001 001a1008 10822000 02080000 11402800 01027603 80000120 18280c90 03100040 d9500058 02000400 8000100e 00800000 1020008c 04000600 2006001b 80000000 00012670 |