On Target RT_HIV1 0.25925925/CHEMBL4227382
For the given ligand Bromfenac, we have found in our database that, being scored 0.25925925, the most similar ligand is CHEMBL4227382. Check out the elaboration below.
| Bromfenac (Given Ligand) | CHEMBL4227382 (Similar Ligand) |
|---|---|
| Nc1c(CC(=O)O)cccc1C(=O)c2ccc(Br)cc2 | C=C(C)[C@@H]1CC[C@]2(CNCCCN(C)c3ccccc3)CC[C@]3(C)[C@H](CC[C@@H]4[C@@]5(C)CC=C(c6ccc(C(=O)O)cc6)C(C)(C)[C@@H]5CC[C@]43C)[C@@H]12 |
|
|
|
|
|
|
| 00004002 00008800 00000100 00010200 00000041 00090000 00000000 01000000 00000000 00080a40 08000004 40009200 01008010 00000000 41060040 08080008 08000000 02000401 00000000 00000000 40000000 08020a00 21000000 00400014 00000000 a0000200 00120000 40804004 00000080 00061002 80002008 28000400 | 00004002 01000c00 00100302 40050600 20000000 00004000 80000080 20000402 00000900 001809e0 08300004 40018800 00028002 00200000 00020442 00080008 00040400 02000020 0a012000 00000201 61100100 18020a30 20008020 00500014 01200000 80000000 00406000 d0000080 00408002 01060012 e4020000 00002600 |