On Target RT_HIV1 0.2826087/CHEMBL4227326
For the given ligand Nepafenac, we have found in our database that, being scored 0.2826087, the most similar ligand is CHEMBL4227326. Check out the elaboration below.
| Nepafenac (Given Ligand) | CHEMBL4227326 (Similar Ligand) |
|---|---|
| NC(=O)Cc2cccc(C(=O)c1ccccc1)c2N | C=C(C)[C@@H]1CC[C@]2(CNCCc3ccccn3)CC[C@]3(C)[C@H](CC[C@@H]4[C@@]5(C)CC=C(c6ccc(C(=O)O)cc6)C(C)(C)[C@@H]5CC[C@]43C)[C@@H]12 |
|
|
|
|
|
|
| 00000002 00000800 00000100 00010600 00001001 00090000 00000000 01000000 00000000 00080a40 08000004 40009200 01008000 00000000 40020040 08080008 00000000 02000001 00000010 00000000 40000000 18020600 20000000 81400014 00000000 a0000200 00000000 40804000 04000080 00060002 80002000 20000400 | 0400000a 01000800 00104322 50050600 00040020 00004000 80000080 20000402 00000980 00180ac0 08308004 40818800 00028802 00200000 01020402 020c000c 00000400 0a000020 02212000 00000201 41000100 18228a30 20808020 81500014 01201000 80000000 00406040 d0000000 04400006 01060002 e4020000 20002600 |