On Target RT_HIV1 0.26953125/CHEMBL4109891
For the given ligand Bendazac, we have found in our database that, being scored 0.26953125, the most similar ligand is CHEMBL4109891. Check out the elaboration below.
| Bendazac (Given Ligand) | CHEMBL4109891 (Similar Ligand) |
|---|---|
| O=C(O)COc2nn(Cc1ccccc1)c3ccccc23 | COC(=O)N[C@H](C(=O)N[C@H](c1ccc([C@@H](CO)N(C(C)C)S(=O)(=O)c2ccc3[nH]ncc3c2)s1)C(F)(F)F)C(c1ccccc1)c1ccccc1 |
|
|
|
|
|
|
| 04000004 02000618 20000108 00210600 000c1040 00000000 06008000 00001000 00100200 000008c0 000c0008 4001c000 0080d806 00e00200 41e40001 021c001c 08002008 82000800 00600000 00260000 00040000 1c018a18 05800801 8b600000 00100840 80000044 00008008 00800000 04000200 00060008 00040000 0a404020 | 00010010 00903208 23180100 05b10601 100c00c0 0003a0e0 06001081 2300500e 00c60b08 c04918c0 09302200 e000b880 8c008812 00602021 80642400 001e020c 18423000 0219000c 00700018 0022720d 80001900 7c288e98 03900800 cb700058 42100800 e4010106 40000800 d040202c 0c200780 2006000f e0004000 00c147e0 |