On Target RT_HIV1 0.2596154/CHEMBL3775172
For the given ligand Flurbiprofen, we have found in our database that, being scored 0.2596154, the most similar ligand is CHEMBL3775172. Check out the elaboration below.
| Flurbiprofen (Given Ligand) | CHEMBL3775172 (Similar Ligand) |
|---|---|
| CC(C(=O)O)c2ccc(c1ccccc1)c(F)c2 | C=C(C)[C@@H]1CC[C@]2(C(=O)O)CC[C@]3(C)[C@H](CC[C@@H]4[C@@]5(C)CC=C(c6ccc(C(=O)O)cc6)C(C)(C)[C@@H]5CC[C@]43C)[C@@H]12 |
|
|
|
|
|
|
| 00002000 00000000 00100100 02010200 00000040 00000010 00000000 00000000 00000100 00082840 08000000 50009800 01008000 00001000 40040000 00080008 08020200 02000000 04000000 10000000 00000000 08000a00 11000000 00400010 00000004 80000000 80000000 00000041 00404000 00028002 00002000 00000600 | 00010000 01000800 00000302 40050200 00080000 00004000 80000080 00000402 00000900 00188848 08100000 40009800 04028008 00a00000 00000402 00080008 00000400 02000020 02402000 00000001 01000100 08020a20 01008020 00400014 01200000 80000000 00406000 c0000000 00400002 01020002 e4020000 00000400 |