On Target NS5B_HCV1A 0.33628318/CHEMBL175894
For the given ligand Bromfenac, we have found in our database that, being scored 0.33628318, the most similar ligand is CHEMBL175894. Check out the elaboration below.
| Bromfenac (Given Ligand) | CHEMBL175894 (Similar Ligand) |
|---|---|
| Nc1c(CC(=O)O)cccc1C(=O)c2ccc(Br)cc2 | N#Cc1ccc(Br)cc1-c1cccc(C(=O)CC(=O)C(=O)O)c1 |
|
|
|
|
|
|
| 00004002 00008800 00000100 00010200 00000041 00090000 00000000 01000000 00000000 00080a40 08000004 40009200 01008010 00000000 41060040 08080008 08000000 02000401 00000000 00000000 40000000 08020a00 21000000 00400014 00000000 a0000200 00120000 40804004 00000080 00061002 80002008 28000400 | 00056000 01008801 00000102 00010200 00080021 00000000 00000000 00000000 54100900 00880840 08100008 c001d000 04008010 00200000 20000000 08082008 00420000 02001000 04c00008 00008001 00000100 08020a00 11000480 00400014 00000800 80000080 00120000 00000041 10004002 00060402 80000008 08400400 |