On Target NS5B_HCV1A 0.32038835/CHEMBL367415
For the given ligand Flurbiprofen, we have found in our database that, being scored 0.32038835, the most similar ligand is CHEMBL367415. Check out the elaboration below.
| Flurbiprofen (Given Ligand) | CHEMBL367415 (Similar Ligand) |
|---|---|
| CC(C(=O)O)c2ccc(c1ccccc1)c(F)c2 | N#Cc1c(Cl)cccc1-c1cccc(C(=O)CC(=O)C(=O)O)c1 |
|
|
|
|
|
|
| 00002000 00000000 00100100 02010200 00000040 00000010 00000000 00000000 00000100 00082840 08000000 50009800 01008000 00001000 40040000 00080008 08020200 02000000 04000000 10000000 00000000 08000a00 11000000 00400010 00000004 80000000 80000000 00000041 00404000 00028002 00002000 00000600 | 0005a000 01000801 00000102 00810200 00080021 00000000 04000000 00000000 04100900 00880840 08100000 4001d800 06008004 00200008 a0000000 08082008 00420000 02001000 04c00008 00002001 00000100 08020b00 11000480 00400014 00002800 80000280 00000000 00000041 10004002 00020402 80000000 00420400 |