On Target NS5B_HCV1B 0.20812182/CHEMBL3645203
For the given ligand Bromfenac, we have found in our database that, being scored 0.20812182, the most similar ligand is CHEMBL3645203. Check out the elaboration below.
| Bromfenac (Given Ligand) | CHEMBL3645203 (Similar Ligand) |
|---|---|
| Nc1c(CC(=O)O)cccc1C(=O)c2ccc(Br)cc2 | CNC(=O)c1c2cc(C3CC3)c(N(C)S(C)(=O)=O)cc2nn1-c1ccc(Br)cc1 |
|
|
|
|
|
|
| 00004002 00008800 00000100 00010200 00000041 00090000 00000000 01000000 00000000 00080a40 08000004 40009200 01008010 00000000 41060040 08080008 08000000 02000401 00000000 00000000 40000000 08020a00 21000000 00400014 00000000 a0000200 00120000 40804004 00000080 00061002 80002008 28000400 | 00004006 0080de08 20080902 40310e00 010c0000 00004002 02040000 02001408 00100900 000908c0 09312024 40118800 80008c33 01400201 800a0040 000e200c 04268000 02000004 08600008 00224201 c0000101 1c838e38 2080c800 8360001c 00104080 c0000040 00270080 8000108c 0c408104 0046004b c4048088 a81147e0 |