On Target NS5B_HCV1B 0.20418848/CHEMBL3645203
For the given ligand Nepafenac, we have found in our database that, being scored 0.20418848, the most similar ligand is CHEMBL3645203. Check out the elaboration below.
| Nepafenac (Given Ligand) | CHEMBL3645203 (Similar Ligand) |
|---|---|
| NC(=O)Cc2cccc(C(=O)c1ccccc1)c2N | CNC(=O)c1c2cc(C3CC3)c(N(C)S(C)(=O)=O)cc2nn1-c1ccc(Br)cc1 |
|
|
|
|
|
|
| 00000002 00000800 00000100 00010600 00001001 00090000 00000000 01000000 00000000 00080a40 08000004 40009200 01008000 00000000 40020040 08080008 00000000 02000001 00000010 00000000 40000000 18020600 20000000 81400014 00000000 a0000200 00000000 40804000 04000080 00060002 80002000 20000400 | 00004006 0080de08 20080902 40310e00 010c0000 00004002 02040000 02001408 00100900 000908c0 09312024 40118800 80008c33 01400201 800a0040 000e200c 04268000 02000004 08600008 00224201 c0000101 1c838e38 2080c800 8360001c 00104080 c0000040 00270080 8000108c 0c408104 0046004b c4048088 a81147e0 |