On Target NS5B_HCV1B 0.2863248/CHEMBL3645180
For the given ligand Bendazac, we have found in our database that, being scored 0.2863248, the most similar ligand is CHEMBL3645180. Check out the elaboration below.
| Bendazac (Given Ligand) | CHEMBL3645180 (Similar Ligand) |
|---|---|
| O=C(O)COc2nn(Cc1ccccc1)c3ccccc23 | CCN(c1cc2nn(-c3ccc(Oc4ccccc4F)cc3)c(C(=O)NC)c2cc1C1CC1)S(C)(=O)=O |
|
|
|
|
|
|
| 04000004 02000618 20000108 00210600 000c1040 00000000 06008000 00001000 00100200 000008c0 000c0008 4001c000 0080d806 00e00200 41e40001 021c001c 08002008 82000800 00600000 00260000 00040000 1c018a18 05800801 8b600000 00100840 80000044 00008008 00800000 04000200 00060008 00040000 0a404020 | 00004006 00805e08 2018090a 43310e00 010c1000 00004052 02040000 02001408 00100900 000908c0 09312024 40118800 80008c23 01401201 810a0841 000e200c 04268800 02000004 08602008 00224201 c0500101 3c838e38 20800800 8360001c 02104080 c0000040 00270080 8020108d 0c488304 0046804b c4048480 a31147e0 |