On Target NS5B_HCV1B 0.16981132/CHEMBL3645205
For the given ligand Flurbiprofen, we have found in our database that, being scored 0.16981132, the most similar ligand is CHEMBL3645205. Check out the elaboration below.
| Flurbiprofen (Given Ligand) | CHEMBL3645205 (Similar Ligand) |
|---|---|
| CC(C(=O)O)c2ccc(c1ccccc1)c(F)c2 | CNC(=O)c1c2cc(C3CC3)c(N(CCC(=O)OC)S(C)(=O)=O)cc2nn1-c1ccc(F)cc1 |
|
|
|
|
|
|
| 00002000 00000000 00100100 02010200 00000040 00000010 00000000 00000000 00000100 00082840 08000000 50009800 01008000 00001000 40040000 00080008 08020200 02000000 04000000 10000000 00000000 08000a00 11000000 00400010 00000004 80000000 80000000 00000041 00404000 00028002 00002000 00000600 | 00004006 00805e08 20180902 43310e00 210c0000 00004052 22040000 02001408 00100900 004908c0 09312034 50119800 88008c23 01401201 810a0040 000e200e 0426c004 02400004 08e00018 00224205 c0100101 1c838e38 21801880 9360001c 02104080 c0000040 00270080 8000108d 0c488304 0046804b c4048080 a01147e0 |