On Target NA_INFB 0.2027027/CHEMBL113191
For the given ligand Nepafenac, we have found in our database that, being scored 0.2027027, the most similar ligand is CHEMBL113191. Check out the elaboration below.
| Nepafenac (Given Ligand) | CHEMBL113191 (Similar Ligand) |
|---|---|
| NC(=O)Cc2cccc(C(=O)c1ccccc1)c2N | CC(=O)N[C@@H]1[C@@H](N)CC(C(=O)O)=C[C@H]1N(C)CCc1ccccc1 |
|
|
|
|
|
|
| 00000002 00000800 00000100 00010600 00001001 00090000 00000000 01000000 00000000 00080a40 08000004 40009200 01008000 00000000 40020040 08080008 00000000 02000001 00000010 00000000 40000000 18020600 20000000 81400014 00000000 a0000200 00000000 40804000 04000080 00060002 80002000 20000400 | 00030010 0900b400 00100100 04010600 00180000 00000000 00180180 3800040a 11000080 001809c8 08200000 41019000 0402811a 01812000 00000400 00080308 20004000 02000160 40412010 00000201 00000000 38240f90 01008001 83500018 00001000 88008c00 00484000 90000000 0c000000 00060413 04020000 02002600 |