On Target NP_HCoV-OC43 0.094339624/CHEMBL3233481
For the given ligand Flurbiprofen, we have found in our database that, being scored 0.094339624, the most similar ligand is CHEMBL3233481. Check out the elaboration below.
| Flurbiprofen (Given Ligand) | CHEMBL3233481 (Similar Ligand) |
|---|---|
| CC(C(=O)O)c2ccc(c1ccccc1)c(F)c2 | CN(C)CC(=O)Nc1ccc2[nH]c(=O)c3ccccc3c2c1.Cl |
|
|
|
|
|
|
| 00002000 00000000 00100100 02010200 00000040 00000010 00000000 00000000 00000100 00082840 08000000 50009800 01008000 00001000 40040000 00080008 08020200 02000000 04000000 10000000 00000000 08000a00 11000000 00400010 00000004 80000000 80000000 00000041 00404000 00028002 00002000 00000600 | 00004002 00800000 00004020 00000600 00040000 00000060 00000000 00000000 06000000 40000a60 04280004 4000a000 00008800 00702000 00100040 00040004 00040000 00000008 08200000 00000004 40100000 28008608 20802000 80100002 00000000 40000000 00000000 00000080 08008000 00060001 00044000 00020200 |