On Target PLP_SARS 0.23225807/CHEMBL213543
For the given ligand Cortisone acetate, we have found in our database that, being scored 0.23225807, the most similar ligand is CHEMBL213543. Check out the elaboration below.
| Cortisone acetate (Given Ligand) | CHEMBL213543 (Similar Ligand) |
|---|---|
| CC(=O)OCC(=O)[C@@]4(O)CC[C@H]3[C@@H]2CC/C1=C/C(=O)CCC1(C)[C@H]2C(=O)C[C@@]34C | CCOC(=O)/C=C/[C@H](C[C@@H]1CCNC1=O)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](NC(=O)OCc1ccccc1)C(C)C |
|
|
|
|
|
|
| 00050000 01000000 00000100 00010300 00080040 00000000 00000080 00000402 01000000 01128000 00000000 4000d000 04028008 00800000 00000400 00081008 00820000 80000020 03412000 02000001 00000020 00000a80 01008000 00000014 00200400 00000000 00404000 80000000 00000200 8100000a 24020000 02000000 | 01030000 0140b000 00100100 04010600 00000000 0001c810 02100080 28000408 01a00300 001088c0 40200000 4003b000 0e028002 00012001 80000400 021a0008 20020000 02080500 20012890 00001201 00002000 38040fb0 00008003 02500018 00001400 8800ac02 00484000 90200120 08000200 00060001 ec004000 02802210 |