On Target PLP_SARS 0.23353294/CHEMBL222735
For the given ligand Bendazac, we have found in our database that, being scored 0.23353294, the most similar ligand is CHEMBL222735. Check out the elaboration below.
| Bendazac (Given Ligand) | CHEMBL222735 (Similar Ligand) |
|---|---|
| O=C(O)COc2nn(Cc1ccccc1)c3ccccc23 | COc1cccc(C(=O)Oc2cncc(Cl)c2)c1 |
|
|
|
|
|
|
| 04000004 02000618 20000108 00210600 000c1040 00000000 06008000 00001000 00100200 000008c0 000c0008 4001c000 0080d806 00e00200 41e40001 021c001c 08002008 82000800 00600000 00260000 00040000 1c018a18 05800801 8b600000 00100840 80000044 00008008 00800000 04000200 00060008 00040000 0a404020 | 04008002 48000808 60004108 00010200 00041000 04004004 82080000 01200000 00000100 00000848 00000004 40048800 0680880e 08010002 01034007 220c000c 00020000 02002000 00280008 00020200 40000000 08028b20 30800000 00c09004 00002c00 80082200 00000200 00000000 00000200 00020000 c0000000 10020000 |