On Target NSP1_SARS 0.1985294/CHEMBL221366
For the given ligand Bromfenac, we have found in our database that, being scored 0.1985294, the most similar ligand is CHEMBL221366. Check out the elaboration below.
| Bromfenac (Given Ligand) | CHEMBL221366 (Similar Ligand) |
|---|---|
| Nc1c(CC(=O)O)cccc1C(=O)c2ccc(Br)cc2 | O=C(Oc1cccnc1)c1cccs1 |
|
|
|
|
|
|
| 00004002 00008800 00000100 00010200 00000041 00090000 00000000 01000000 00000000 00080a40 08000004 40009200 01008010 00000000 41060040 08080008 08000000 02000401 00000000 00000000 40000000 08020a00 21000000 00400014 00000000 a0000200 00120000 40804004 00000080 00061002 80002008 28000400 | 04010042 04000808 60004108 20000200 00041040 04004084 00080080 00200000 00000100 00000040 00000204 40048080 00808814 08010000 01032000 060c000c 09030000 02002008 00200000 00020010 40002060 48008a80 30900000 10c09004 02002400 04082000 00000200 80000004 00000200 00020000 c0000000 10c10000 |