On Target NSP1_SARS 0.31914893/CHEMBL1092796
For the given ligand Cortisone acetate, we have found in our database that, being scored 0.31914893, the most similar ligand is CHEMBL1092796. Check out the elaboration below.
| Cortisone acetate (Given Ligand) | CHEMBL1092796 (Similar Ligand) |
|---|---|
| CC(=O)OCC(=O)[C@@]4(O)CC[C@H]3[C@@H]2CC/C1=C/C(=O)CCC1(C)[C@H]2C(=O)C[C@@]34C | CC1=CC[C@]2(C)CC[C@]3(C)C4=CC=C5C(=CC(=O)C(O)=C5C)[C@]4(C)CC[C@@]3(C)[C@@H]2C1 |
|
|
|
|
|
|
| 00050000 01000000 00000100 00010300 00080040 00000000 00000080 00000402 01000000 01128000 00000000 4000d000 04028008 00800000 00000400 00081008 00820000 80000020 03412000 02000001 00000020 00000a80 01008000 00000014 00200400 00000000 00404000 80000000 00000200 8100000a 24020000 02000000 | 00000402 01040000 00000800 00080000 40402000 00000001 00000080 02000402 01000000 00100000 00000200 40404200 80028000 20000000 00000404 0008040c 00000000 00000020 02092080 00020001 00002001 00000280 01008000 00000812 00200000 00000000 00404240 80800000 00004000 00000000 24820000 04000000 |